About 3,5-difluorobenzenethiol;methane;dihydrochloride
3,5-difluorobenzenethiol;methane;dihydrochloride (PubChem CID 174757194) has the molecular formula C7H10Cl2F2S
and a molecular weight of 235.13 g/mol. Its IUPAC name is 3,5-difluorobenzenethiol;methane;dihydrochloride.
Molecular Properties
| Compound Name | 3,5-difluorobenzenethiol;methane;dihydrochloride |
| PubChem CID | 174757194 |
| Molecular Formula | C7H10Cl2F2S |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 3,5-difluorobenzenethiol;methane;dihydrochloride |
| SMILES | C.Cl.Cl.Fc1cc(F)cc(S)c1 |
| InChI | InChI=1S/C6H4F2S.CH4.2ClH/c7-4-1-5(8)3-6(9)2-4;;;/h1-3,9H;1H4;2*1H |
| InChIKey | KKIPXSCUARNJBK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluorobenzenethiol;methane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluorobenzenethiol;methane;dihydrochloride?
The IUPAC name of 3,5-difluorobenzenethiol;methane;dihydrochloride (CID 174757194) is 3,5-difluorobenzenethiol;methane;dihydrochloride.
What is the SMILES notation for 3,5-difluorobenzenethiol;methane;dihydrochloride?
The canonical SMILES for 3,5-difluorobenzenethiol;methane;dihydrochloride is C.Cl.Cl.Fc1cc(F)cc(S)c1.
What is the InChIKey of 3,5-difluorobenzenethiol;methane;dihydrochloride?
The InChIKey is KKIPXSCUARNJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2S.CH4.2ClH/c7-4-1-5(8)3-6(9)2-4;;;/h1-3,9H;1H4;2*1H.
What are the key properties of 3,5-difluorobenzenethiol;methane;dihydrochloride?
3,5-difluorobenzenethiol;methane;dihydrochloride has a molecular weight of 235.13 g/mol, XLogP of 3.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluorobenzenethiol;methane;dihydrochloride is sourced from PubChem (CID 174757194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).