C6H3Cl2F2P — CID 22925460
dichloro-(3,5-difluorophenyl)phosphane (PubChem CID 22925460) has the molecular formula C6H3Cl2F2P and a molecular weight of 214.97 g/mol. Its IUPAC name is dichloro-(3,5-difluorophenyl)phosphane.
| Compound Name | dichloro-(3,5-difluorophenyl)phosphane |
|---|---|
| PubChem CID | 22925460 |
| Molecular Formula | C6H3Cl2F2P |
| Molecular Weight | 214.97 g/mol |
| Exact Mass | 213.93 |
| IUPAC Name | dichloro-(3,5-difluorophenyl)phosphane |
| SMILES | Fc1cc(F)cc(P(Cl)Cl)c1 |
| InChI | InChI=1S/C6H3Cl2F2P/c7-11(8)6-2-4(9)1-5(10)3-6/h1-3H |
| InChIKey | ASVHJNMIYUIVGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|