C39H24F12NP3 — CID 132563501
1-bis(3,5-difluorophenyl)phosphanyl-N,N-bis[bis(3,5-difluorophenyl)phosphanylmethyl]methanamine (PubChem CID 132563501) has the molecular formula C39H24F12NP3 and a molecular weight of 827.53 g/mol. Its IUPAC name is 1-bis(3,5-difluorophenyl)phosphanyl-N,N-bis[bis(3,5-difluorophenyl)phosphanylmethyl]methanamine.
| Compound Name | 1-bis(3,5-difluorophenyl)phosphanyl-N,N-bis[bis(3,5-difluorophenyl)phosphanylmethyl]methanamine |
|---|---|
| PubChem CID | 132563501 |
| Molecular Formula | C39H24F12NP3 |
| Molecular Weight | 827.53 g/mol |
| Exact Mass | 827.09 |
| IUPAC Name | 1-bis(3,5-difluorophenyl)phosphanyl-N,N-bis[bis(3,5-difluorophenyl)phosphanylmethyl]methanamine |
| SMILES | Fc1cc(F)cc(P(CN(CP(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)CP(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C39H24F12NP3/c40-22-1-23(41)8-34(7-22)53(35-9-24(42)2-25(43)10-35)19-52(20-54(36-11-26(44)3-27(45)12-36)37-13-28(46)4-29(47)14-37)21-55(38-15-30(48)5-31(49)16-38)39-17-32(50)6-33(51)18-39/h1-18H,19-21H2 |
| InChIKey | QVKWMHHEJBJRIP-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.53 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|