C7H6F2S2 — CID 143472792
1-(disulfanylmethyl)-3,5-difluorobenzene (PubChem CID 143472792) has the molecular formula C7H6F2S2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 1-(disulfanylmethyl)-3,5-difluorobenzene.
| Compound Name | 1-(disulfanylmethyl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 143472792 |
| Molecular Formula | C7H6F2S2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | 1-(disulfanylmethyl)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(CSS)c1 |
| InChI | InChI=1S/C7H6F2S2/c8-6-1-5(4-11-10)2-7(9)3-6/h1-3,10H,4H2 |
| InChIKey | BJRUAEJIXRMKDR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|