C10H11F2NS — CID 142354034
(3,5-difluorophenyl)methyl thiocyanate;ethane (PubChem CID 142354034) has the molecular formula C10H11F2NS and a molecular weight of 215.27 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl thiocyanate;ethane.
| Compound Name | (3,5-difluorophenyl)methyl thiocyanate;ethane |
|---|---|
| PubChem CID | 142354034 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (3,5-difluorophenyl)methyl thiocyanate;ethane |
| SMILES | CC.N#CSCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H5F2NS.C2H6/c9-7-1-6(4-12-5-11)2-8(10)3-7;1-2/h1-3H,4H2;1-2H3 |
| InChIKey | OHQPDJVEGFJUEL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|