About acetonitrile;1,3-difluoro-5-methylbenzene
acetonitrile;1,3-difluoro-5-methylbenzene (PubChem CID 142843655) has the molecular formula C9H9F2N
and a molecular weight of 169.17 g/mol. Its IUPAC name is acetonitrile;1,3-difluoro-5-methylbenzene.
Molecular Properties
| Compound Name | acetonitrile;1,3-difluoro-5-methylbenzene |
| PubChem CID | 142843655 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | acetonitrile;1,3-difluoro-5-methylbenzene |
| SMILES | CC#N.Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H6F2.C2H3N/c1-5-2-6(8)4-7(9)3-5;1-2-3/h2-4H,1H3;1H3 |
| InChIKey | SCXFWOHBOSOTGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetonitrile;1,3-difluoro-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1,3-difluoro-5-methylbenzene?
The IUPAC name of acetonitrile;1,3-difluoro-5-methylbenzene (CID 142843655) is acetonitrile;1,3-difluoro-5-methylbenzene.
What is the SMILES notation for acetonitrile;1,3-difluoro-5-methylbenzene?
The canonical SMILES for acetonitrile;1,3-difluoro-5-methylbenzene is CC#N.Cc1cc(F)cc(F)c1.
What is the InChIKey of acetonitrile;1,3-difluoro-5-methylbenzene?
The InChIKey is SCXFWOHBOSOTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2.C2H3N/c1-5-2-6(8)4-7(9)3-5;1-2-3/h2-4H,1H3;1H3.
What are the key properties of acetonitrile;1,3-difluoro-5-methylbenzene?
acetonitrile;1,3-difluoro-5-methylbenzene has a molecular weight of 169.17 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1,3-difluoro-5-methylbenzene is sourced from PubChem (CID 142843655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).