C8H5F4N — CID 155234627
acetonitrile;1,2,4,5-tetrafluorobenzene (PubChem CID 155234627) has the molecular formula C8H5F4N and a molecular weight of 191.13 g/mol. Its IUPAC name is acetonitrile;1,2,4,5-tetrafluorobenzene.
| Compound Name | acetonitrile;1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 155234627 |
| Molecular Formula | C8H5F4N |
| Molecular Weight | 191.13 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | acetonitrile;1,2,4,5-tetrafluorobenzene |
| SMILES | CC#N.Fc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C6H2F4.C2H3N/c7-3-1-4(8)6(10)2-5(3)9;1-2-3/h1-2H;1H3 |
| InChIKey | RLJJUDCCZMYWRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|