C7H5F3S — CID 118589493
(2,3,5-trifluorophenyl)methanethiol (PubChem CID 118589493) has the molecular formula C7H5F3S and a molecular weight of 178.18 g/mol. Its IUPAC name is (2,3,5-trifluorophenyl)methanethiol.
| Compound Name | (2,3,5-trifluorophenyl)methanethiol |
|---|---|
| PubChem CID | 118589493 |
| Molecular Formula | C7H5F3S |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | (2,3,5-trifluorophenyl)methanethiol |
| SMILES | Fc1cc(F)c(F)c(CS)c1 |
| InChI | InChI=1S/C7H5F3S/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2,11H,3H2 |
| InChIKey | NOLOJQNHUQFWKC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|