About ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene
ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene (PubChem CID 168922345) has the molecular formula C11H15F3O
and a molecular weight of 220.23 g/mol. Its IUPAC name is ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene.
Molecular Properties
| Compound Name | ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene |
| PubChem CID | 168922345 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene |
| SMILES | CC.CCOCc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C9H9F3O.C2H6/c1-2-13-5-6-3-7(10)4-8(11)9(6)12;1-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | CFPZXKKPZXNPFS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene?
The IUPAC name of ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene (CID 168922345) is ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene.
What is the SMILES notation for ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene?
The canonical SMILES for ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene is CC.CCOCc1cc(F)cc(F)c1F.
What is the InChIKey of ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene?
The InChIKey is CFPZXKKPZXNPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3O.C2H6/c1-2-13-5-6-3-7(10)4-8(11)9(6)12;1-2/h3-4H,2,5H2,1H3;1-2H3.
What are the key properties of ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene?
ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene has a molecular weight of 220.23 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(ethoxymethyl)-2,3,5-trifluorobenzene is sourced from PubChem (CID 168922345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).