C11H12F3NO — CID 174865595
2-[(2,3,5-trifluorophenyl)methyl]butanamide (PubChem CID 174865595) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-[(2,3,5-trifluorophenyl)methyl]butanamide.
| Compound Name | 2-[(2,3,5-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 174865595 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[(2,3,5-trifluorophenyl)methyl]butanamide |
| SMILES | CCC(Cc1cc(F)cc(F)c1F)C(N)=O |
| InChI | InChI=1S/C11H12F3NO/c1-2-6(11(15)16)3-7-4-8(12)5-9(13)10(7)14/h4-6H,2-3H2,1H3,(H2,15,16) |
| InChIKey | JICWZPISLMNXCJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|