C11H9F2NO2 — CID 143317392
3-ethyl-5,7-difluoro-1-benzofuran-2-carboxamide (PubChem CID 143317392) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 3-ethyl-5,7-difluoro-1-benzofuran-2-carboxamide.
| Compound Name | 3-ethyl-5,7-difluoro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 143317392 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-ethyl-5,7-difluoro-1-benzofuran-2-carboxamide |
| SMILES | CCc1c(C(N)=O)oc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C11H9F2NO2/c1-2-6-7-3-5(12)4-8(13)9(7)16-10(6)11(14)15/h3-4H,2H2,1H3,(H2,14,15) |
| InChIKey | YVFAVJMYVZHICP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |