C14H18F3NO2 — CID 11219971
2-(aminomethyl)-4-[(2,3,5-trifluorophenyl)methyl]hexanoic acid (PubChem CID 11219971) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[(2,3,5-trifluorophenyl)methyl]hexanoic acid.
| Compound Name | 2-(aminomethyl)-4-[(2,3,5-trifluorophenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 11219971 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(aminomethyl)-4-[(2,3,5-trifluorophenyl)methyl]hexanoic acid |
| SMILES | CCC(Cc1cc(F)cc(F)c1F)CC(CN)C(=O)O |
| InChI | InChI=1S/C14H18F3NO2/c1-2-8(4-10(7-18)14(19)20)3-9-5-11(15)6-12(16)13(9)17/h5-6,8,10H,2-4,7,18H2,1H3,(H,19,20) |
| InChIKey | QDCMAIHFOVKFGQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|