C8H7BrF2O — CID 130786949
2-(bromomethyl)-1,5-difluoro-3-methoxybenzene (PubChem CID 130786949) has the molecular formula C8H7BrF2O and a molecular weight of 237.04 g/mol. Its IUPAC name is 2-(bromomethyl)-1,5-difluoro-3-methoxybenzene.
| Compound Name | 2-(bromomethyl)-1,5-difluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 130786949 |
| Molecular Formula | C8H7BrF2O |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-(bromomethyl)-1,5-difluoro-3-methoxybenzene |
| SMILES | COc1cc(F)cc(F)c1CBr |
| InChI | InChI=1S/C8H7BrF2O/c1-12-8-3-5(10)2-7(11)6(8)4-9/h2-3H,4H2,1H3 |
| InChIKey | ZFIFYTAQCSRUNP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|