C11H15FO — CID 175600199
2,5-diethyl-1-fluoro-3-methoxybenzene (PubChem CID 175600199) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is 2,5-diethyl-1-fluoro-3-methoxybenzene.
| Compound Name | 2,5-diethyl-1-fluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 175600199 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2,5-diethyl-1-fluoro-3-methoxybenzene |
| SMILES | CCc1cc(F)c(CC)c(OC)c1 |
| InChI | InChI=1S/C11H15FO/c1-4-8-6-10(12)9(5-2)11(7-8)13-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | VMANYPXDYHZSJT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |