C13H12BrFN2O3 — CID 141092576
2-[2-(bromomethyl)-3-fluorophenoxy]-4,6-dimethoxypyrimidine (PubChem CID 141092576) has the molecular formula C13H12BrFN2O3 and a molecular weight of 343.15 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-fluorophenoxy]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[2-(bromomethyl)-3-fluorophenoxy]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 141092576 |
| Molecular Formula | C13H12BrFN2O3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-[2-(bromomethyl)-3-fluorophenoxy]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(Oc2cccc(F)c2CBr)n1 |
| InChI | InChI=1S/C13H12BrFN2O3/c1-18-11-6-12(19-2)17-13(16-11)20-10-5-3-4-9(15)8(10)7-14/h3-6H,7H2,1-2H3 |
| InChIKey | DQWGXJAGTUKSMF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|