C15H18N2O5 — CID 19801417
2-[2-(dimethoxymethyl)phenoxy]-4,6-dimethoxypyrimidine (PubChem CID 19801417) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[2-(dimethoxymethyl)phenoxy]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[2-(dimethoxymethyl)phenoxy]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 19801417 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[2-(dimethoxymethyl)phenoxy]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C(OC)OC)n1 |
| InChI | InChI=1S/C15H18N2O5/c1-18-12-9-13(19-2)17-15(16-12)22-11-8-6-5-7-10(11)14(20-3)21-4/h5-9,14H,1-4H3 |
| InChIKey | VNGKTLJLZQJARY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|