C9H10F2O — CID 117276930
(5-ethyl-2,3-difluorophenyl)methanol (PubChem CID 117276930) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is (5-ethyl-2,3-difluorophenyl)methanol.
| Compound Name | (5-ethyl-2,3-difluorophenyl)methanol |
|---|---|
| PubChem CID | 117276930 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (5-ethyl-2,3-difluorophenyl)methanol |
| SMILES | CCc1cc(F)c(F)c(CO)c1 |
| InChI | InChI=1S/C9H10F2O/c1-2-6-3-7(5-12)9(11)8(10)4-6/h3-4,12H,2,5H2,1H3 |
| InChIKey | TWTSHFNQOFHRGA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |