C6H5F3IP — CID 175314660
phosphane;1,3,5-trifluoro-2-iodobenzene (PubChem CID 175314660) has the molecular formula C6H5F3IP and a molecular weight of 291.98 g/mol. Its IUPAC name is phosphane;1,3,5-trifluoro-2-iodobenzene.
| Compound Name | phosphane;1,3,5-trifluoro-2-iodobenzene |
|---|---|
| PubChem CID | 175314660 |
| Molecular Formula | C6H5F3IP |
| Molecular Weight | 291.98 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | phosphane;1,3,5-trifluoro-2-iodobenzene |
| SMILES | Fc1cc(F)c(I)c(F)c1.P |
| InChI | InChI=1S/C6H2F3I.H3P/c7-3-1-4(8)6(10)5(9)2-3;/h1-2H;1H3 |
| InChIKey | UPYPBGRACVCJGS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|