C13H9F3IN — CID 43124899
(4-iodophenyl)-(2,4,6-trifluorophenyl)methanamine (PubChem CID 43124899) has the molecular formula C13H9F3IN and a molecular weight of 363.12 g/mol. Its IUPAC name is (4-iodophenyl)-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | (4-iodophenyl)-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 43124899 |
| Molecular Formula | C13H9F3IN |
| Molecular Weight | 363.12 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | (4-iodophenyl)-(2,4,6-trifluorophenyl)methanamine |
| SMILES | NC(c1ccc(I)cc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H9F3IN/c14-8-5-10(15)12(11(16)6-8)13(18)7-1-3-9(17)4-2-7/h1-6,13H,18H2 |
| InChIKey | QMZHEMWGIDOSTJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|