C17H18F3N — CID 65101153
(4-butan-2-ylphenyl)-(2,4,6-trifluorophenyl)methanamine (PubChem CID 65101153) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | (4-butan-2-ylphenyl)-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 65101153 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (4-butan-2-ylphenyl)-(2,4,6-trifluorophenyl)methanamine |
| SMILES | CCC(C)c1ccc(C(N)c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H18F3N/c1-3-10(2)11-4-6-12(7-5-11)17(21)16-14(19)8-13(18)9-15(16)20/h4-10,17H,3,21H2,1-2H3 |
| InChIKey | MCYXHKFFEHEVGM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |