C18H25NO — CID 65151193
(4-butan-2-ylphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine (PubChem CID 65151193) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine.
| Compound Name | (4-butan-2-ylphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine |
|---|---|
| PubChem CID | 65151193 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (4-butan-2-ylphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine |
| SMILES | CCC(C)c1ccc(C(N)c2c(C)oc(C)c2C)cc1 |
| InChI | InChI=1S/C18H25NO/c1-6-11(2)15-7-9-16(10-8-15)18(19)17-12(3)13(4)20-14(17)5/h7-11,18H,6,19H2,1-5H3 |
| InChIKey | KTAKIDITQVTTNB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |