C19H25N — CID 43108648
(4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanamine (PubChem CID 43108648) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanamine.
| Compound Name | (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 43108648 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanamine |
| SMILES | CCC(C)c1ccc(C(N)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C19H25N/c1-5-13(2)16-8-10-17(11-9-16)19(20)18-7-6-14(3)15(4)12-18/h6-13,19H,5,20H2,1-4H3 |
| InChIKey | MTJIXYXWZGZSIN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |