C19H24O — CID 63426275
(4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanol (PubChem CID 63426275) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanol.
| Compound Name | (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 63426275 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (4-butan-2-ylphenyl)-(3,4-dimethylphenyl)methanol |
| SMILES | CCC(C)c1ccc(C(O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C19H24O/c1-5-13(2)16-8-10-17(11-9-16)19(20)18-7-6-14(3)15(4)12-18/h6-13,19-20H,5H2,1-4H3 |
| InChIKey | DHPVJDPOARGLBI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |