C17H22OS — CID 65238991
(4-butan-2-ylphenyl)-(4,5-dimethylthiophen-2-yl)methanol (PubChem CID 65238991) has the molecular formula C17H22OS and a molecular weight of 274.43 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(4,5-dimethylthiophen-2-yl)methanol.
| Compound Name | (4-butan-2-ylphenyl)-(4,5-dimethylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 65238991 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (4-butan-2-ylphenyl)-(4,5-dimethylthiophen-2-yl)methanol |
| SMILES | CCC(C)c1ccc(C(O)c2cc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C17H22OS/c1-5-11(2)14-6-8-15(9-7-14)17(18)16-10-12(3)13(4)19-16/h6-11,17-18H,5H2,1-4H3 |
| InChIKey | LDOJRNLUMJCZFO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |