About phenyl-(2,4,6-trifluorophenyl)methanamine
phenyl-(2,4,6-trifluorophenyl)methanamine (PubChem CID 43198681) has the molecular formula C13H10F3N
and a molecular weight of 237.22 g/mol. Its IUPAC name is phenyl-(2,4,6-trifluorophenyl)methanamine.
Molecular Properties
| Compound Name | phenyl-(2,4,6-trifluorophenyl)methanamine |
| PubChem CID | 43198681 |
| Molecular Formula | C13H10F3N |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | phenyl-(2,4,6-trifluorophenyl)methanamine |
| SMILES | NC(c1ccccc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H10F3N/c14-9-6-10(15)12(11(16)7-9)13(17)8-4-2-1-3-5-8/h1-7,13H,17H2 |
| InChIKey | MVGGLKJSDBRFFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenyl-(2,4,6-trifluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2,4,6-trifluorophenyl)methanamine?
The IUPAC name of phenyl-(2,4,6-trifluorophenyl)methanamine (CID 43198681) is phenyl-(2,4,6-trifluorophenyl)methanamine.
What is the SMILES notation for phenyl-(2,4,6-trifluorophenyl)methanamine?
The canonical SMILES for phenyl-(2,4,6-trifluorophenyl)methanamine is NC(c1ccccc1)c1c(F)cc(F)cc1F.
What is the InChIKey of phenyl-(2,4,6-trifluorophenyl)methanamine?
The InChIKey is MVGGLKJSDBRFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N/c14-9-6-10(15)12(11(16)7-9)13(17)8-4-2-1-3-5-8/h1-7,13H,17H2.
What are the key properties of phenyl-(2,4,6-trifluorophenyl)methanamine?
phenyl-(2,4,6-trifluorophenyl)methanamine has a molecular weight of 237.22 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2,4,6-trifluorophenyl)methanamine is sourced from PubChem (CID 43198681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).