C13H7BrF3I — CID 63438762
2-[bromo-(4-iodophenyl)methyl]-1,3,5-trifluorobenzene (PubChem CID 63438762) has the molecular formula C13H7BrF3I and a molecular weight of 427.00 g/mol. Its IUPAC name is 2-[bromo-(4-iodophenyl)methyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[bromo-(4-iodophenyl)methyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 63438762 |
| Molecular Formula | C13H7BrF3I |
| Molecular Weight | 427.00 g/mol |
| Exact Mass | 425.87 |
| IUPAC Name | 2-[bromo-(4-iodophenyl)methyl]-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Br)c2ccc(I)cc2)c(F)c1 |
| InChI | InChI=1S/C13H7BrF3I/c14-13(7-1-3-9(18)4-2-7)12-10(16)5-8(15)6-11(12)17/h1-6,13H |
| InChIKey | FEQOFQZEWQOULE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|