C11H6BrF3O — CID 61097897
2-[bromo-(2,4,6-trifluorophenyl)methyl]furan (PubChem CID 61097897) has the molecular formula C11H6BrF3O and a molecular weight of 291.07 g/mol. Its IUPAC name is 2-[bromo-(2,4,6-trifluorophenyl)methyl]furan.
| Compound Name | 2-[bromo-(2,4,6-trifluorophenyl)methyl]furan |
|---|---|
| PubChem CID | 61097897 |
| Molecular Formula | C11H6BrF3O |
| Molecular Weight | 291.07 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 2-[bromo-(2,4,6-trifluorophenyl)methyl]furan |
| SMILES | Fc1cc(F)c(C(Br)c2ccco2)c(F)c1 |
| InChI | InChI=1S/C11H6BrF3O/c12-11(9-2-1-3-16-9)10-7(14)4-6(13)5-8(10)15/h1-5,11H |
| InChIKey | ZWDHGVXHNOPHEL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|