C14H11F3N2O4 — CID 111799107
N'-[1-(furan-2-yl)-2-hydroxyethyl]-N-(2,4,6-trifluorophenyl)oxamide (PubChem CID 111799107) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is N'-[1-(furan-2-yl)-2-hydroxyethyl]-N-(2,4,6-trifluorophenyl)oxamide.
| Compound Name | N'-[1-(furan-2-yl)-2-hydroxyethyl]-N-(2,4,6-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 111799107 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N'-[1-(furan-2-yl)-2-hydroxyethyl]-N-(2,4,6-trifluorophenyl)oxamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)C(=O)NC(CO)c1ccco1 |
| InChI | InChI=1S/C14H11F3N2O4/c15-7-4-8(16)12(9(17)5-7)19-14(22)13(21)18-10(6-20)11-2-1-3-23-11/h1-5,10,20H,6H2,(H,18,21)(H,19,22) |
| InChIKey | NOXVFRHGLYKXAB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|