C18H15FN2O4 — CID 131701808
N-[2,2-bis(furan-2-yl)ethyl]-N'-(3-fluorophenyl)oxamide (PubChem CID 131701808) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 131701808 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]-N'-(3-fluorophenyl)oxamide |
| SMILES | O=C(NCC(c1ccco1)c1ccco1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H15FN2O4/c19-12-4-1-5-13(10-12)21-18(23)17(22)20-11-14(15-6-2-8-24-15)16-7-3-9-25-16/h1-10,14H,11H2,(H,20,22)(H,21,23) |
| InChIKey | TZHSEALGJMHIOU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|