C17H16BrF3 — CID 65100639
3-[bromo-(2,4,6-trifluorophenyl)methyl]-1,2,4,5-tetramethylbenzene (PubChem CID 65100639) has the molecular formula C17H16BrF3 and a molecular weight of 357.21 g/mol. Its IUPAC name is 3-[bromo-(2,4,6-trifluorophenyl)methyl]-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-[bromo-(2,4,6-trifluorophenyl)methyl]-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 65100639 |
| Molecular Formula | C17H16BrF3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 3-[bromo-(2,4,6-trifluorophenyl)methyl]-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C(Br)c2c(F)cc(F)cc2F)c1C |
| InChI | InChI=1S/C17H16BrF3/c1-8-5-9(2)11(4)15(10(8)3)17(18)16-13(20)6-12(19)7-14(16)21/h5-7,17H,1-4H3 |
| InChIKey | FGMSTIKWOGDHCX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|