About 2-(4-fluorophenyl)-1,3,5-trimethylbenzene
2-(4-fluorophenyl)-1,3,5-trimethylbenzene (PubChem CID 12577269) has the molecular formula C15H15F
and a molecular weight of 214.28 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1,3,5-trimethylbenzene |
| PubChem CID | 12577269 |
| Molecular Formula | C15H15F |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(4-fluorophenyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(-c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C15H15F/c1-10-8-11(2)15(12(3)9-10)13-4-6-14(16)7-5-13/h4-9H,1-3H3 |
| InChIKey | SDTDOPMIMJWAAA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(4-fluorophenyl)-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1,3,5-trimethylbenzene?
The IUPAC name of 2-(4-fluorophenyl)-1,3,5-trimethylbenzene (CID 12577269) is 2-(4-fluorophenyl)-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(4-fluorophenyl)-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(4-fluorophenyl)-1,3,5-trimethylbenzene is Cc1cc(C)c(-c2ccc(F)cc2)c(C)c1.
What is the InChIKey of 2-(4-fluorophenyl)-1,3,5-trimethylbenzene?
The InChIKey is SDTDOPMIMJWAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F/c1-10-8-11(2)15(12(3)9-10)13-4-6-14(16)7-5-13/h4-9H,1-3H3.
What are the key properties of 2-(4-fluorophenyl)-1,3,5-trimethylbenzene?
2-(4-fluorophenyl)-1,3,5-trimethylbenzene has a molecular weight of 214.28 g/mol, XLogP of 4.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1,3,5-trimethylbenzene is sourced from PubChem (CID 12577269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).