C13H8BrF3 — CID 61086298
2-[bromo-(4-fluorophenyl)methyl]-1,3-difluorobenzene (PubChem CID 61086298) has the molecular formula C13H8BrF3 and a molecular weight of 301.11 g/mol. Its IUPAC name is 2-[bromo-(4-fluorophenyl)methyl]-1,3-difluorobenzene.
| Compound Name | 2-[bromo-(4-fluorophenyl)methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 61086298 |
| Molecular Formula | C13H8BrF3 |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-[bromo-(4-fluorophenyl)methyl]-1,3-difluorobenzene |
| SMILES | Fc1ccc(C(Br)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C13H8BrF3/c14-13(8-4-6-9(15)7-5-8)12-10(16)2-1-3-11(12)17/h1-7,13H |
| InChIKey | RHDMZCXWECKTNM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|