C14H9ClF4 — CID 55200409
2-[chloro-(4-fluoro-3-methylphenyl)methyl]-1,3,5-trifluorobenzene (PubChem CID 55200409) has the molecular formula C14H9ClF4 and a molecular weight of 288.67 g/mol. Its IUPAC name is 2-[chloro-(4-fluoro-3-methylphenyl)methyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[chloro-(4-fluoro-3-methylphenyl)methyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 55200409 |
| Molecular Formula | C14H9ClF4 |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-[chloro-(4-fluoro-3-methylphenyl)methyl]-1,3,5-trifluorobenzene |
| SMILES | Cc1cc(C(Cl)c2c(F)cc(F)cc2F)ccc1F |
| InChI | InChI=1S/C14H9ClF4/c1-7-4-8(2-3-10(7)17)14(15)13-11(18)5-9(16)6-12(13)19/h2-6,14H,1H3 |
| InChIKey | ZGNMIMLJFJOHDO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|