C14H10ClF3O2S — CID 61084333
2-[chloro-(4-methylsulfonylphenyl)methyl]-1,3,5-trifluorobenzene (PubChem CID 61084333) has the molecular formula C14H10ClF3O2S and a molecular weight of 334.75 g/mol. Its IUPAC name is 2-[chloro-(4-methylsulfonylphenyl)methyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[chloro-(4-methylsulfonylphenyl)methyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 61084333 |
| Molecular Formula | C14H10ClF3O2S |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[chloro-(4-methylsulfonylphenyl)methyl]-1,3,5-trifluorobenzene |
| SMILES | CS(=O)(=O)c1ccc(C(Cl)c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C14H10ClF3O2S/c1-21(19,20)10-4-2-8(3-5-10)14(15)13-11(17)6-9(16)7-12(13)18/h2-7,14H,1H3 |
| InChIKey | AMNOLSAOLBJBRF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|