C17H17F2NO3S — CID 75870193
2,4-difluoro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 75870193) has the molecular formula C17H17F2NO3S and a molecular weight of 353.39 g/mol. Its IUPAC name is 2,4-difluoro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 75870193 |
| Molecular Formula | C17H17F2NO3S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2,4-difluoro-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CC(c1ccc(S(C)(=O)=O)cc1)N(C)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2NO3S/c1-11(12-4-7-14(8-5-12)24(3,22)23)20(2)17(21)15-9-6-13(18)10-16(15)19/h4-11H,1-3H3 |
| InChIKey | XRRSZTZEPVHNAN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |