C20H22F2N2O4S — CID 25489927
2,4-difluoro-N-[4-[[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]-4-oxobutyl]benzamide (PubChem CID 25489927) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 25489927 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2,4-difluoro-N-[4-[[(1R)-1-(4-methylsulfonylphenyl)ethyl]amino]-4-oxobutyl]benzamide |
| SMILES | C[C@@H](NC(=O)CCCNC(=O)c1ccc(F)cc1F)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H22F2N2O4S/c1-13(14-5-8-16(9-6-14)29(2,27)28)24-19(25)4-3-11-23-20(26)17-10-7-15(21)12-18(17)22/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,26)(H,24,25)/t13-/m1/s1 |
| InChIKey | FJVYVPJNTKAZSC-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|