C21H23F3N2O2 — CID 24625565
2,4-difluoro-N-[4-[[1-(4-fluorophenyl)-2-methylpropyl]amino]-4-oxobutyl]benzamide (PubChem CID 24625565) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[[1-(4-fluorophenyl)-2-methylpropyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[[1-(4-fluorophenyl)-2-methylpropyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 24625565 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2,4-difluoro-N-[4-[[1-(4-fluorophenyl)-2-methylpropyl]amino]-4-oxobutyl]benzamide |
| SMILES | CC(C)C(NC(=O)CCCNC(=O)c1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23F3N2O2/c1-13(2)20(14-5-7-15(22)8-6-14)26-19(27)4-3-11-25-21(28)17-10-9-16(23)12-18(17)24/h5-10,12-13,20H,3-4,11H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | MZOFWMOBJIGXDB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|