C20H20F2N2O4 — CID 119367087
(2R)-2-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]-3-phenylpropanoic acid (PubChem CID 119367087) has the molecular formula C20H20F2N2O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is (2R)-2-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119367087 |
| Molecular Formula | C20H20F2N2O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (2R)-2-[4-[(2,4-difluorobenzoyl)amino]butanoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H20F2N2O4/c21-14-8-9-15(16(22)12-14)19(26)23-10-4-7-18(25)24-17(20(27)28)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12,17H,4,7,10-11H2,(H,23,26)(H,24,25)(H,27,28)/t17-/m1/s1 |
| InChIKey | AFESWYNMQIJUJT-QGZVFWFLSA-N |
| XLogP | 2.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|