About 2,4-difluoro-3,6-diiodophenol
2,4-difluoro-3,6-diiodophenol (PubChem CID 156656919) has the molecular formula C6H2F2I2O
and a molecular weight of 381.89 g/mol. Its IUPAC name is 2,4-difluoro-3,6-diiodophenol.
Molecular Properties
| Compound Name | 2,4-difluoro-3,6-diiodophenol |
| PubChem CID | 156656919 |
| Molecular Formula | C6H2F2I2O |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.82 |
| IUPAC Name | 2,4-difluoro-3,6-diiodophenol |
| SMILES | Oc1c(I)cc(F)c(I)c1F |
| InChI | InChI=1S/C6H2F2I2O/c7-2-1-3(9)6(11)4(8)5(2)10/h1,11H |
| InChIKey | NKZILEFRBUHVBK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-3,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-3,6-diiodophenol?
The IUPAC name of 2,4-difluoro-3,6-diiodophenol (CID 156656919) is 2,4-difluoro-3,6-diiodophenol.
What is the SMILES notation for 2,4-difluoro-3,6-diiodophenol?
The canonical SMILES for 2,4-difluoro-3,6-diiodophenol is Oc1c(I)cc(F)c(I)c1F.
What is the InChIKey of 2,4-difluoro-3,6-diiodophenol?
The InChIKey is NKZILEFRBUHVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F2I2O/c7-2-1-3(9)6(11)4(8)5(2)10/h1,11H.
What are the key properties of 2,4-difluoro-3,6-diiodophenol?
2,4-difluoro-3,6-diiodophenol has a molecular weight of 381.89 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3,6-diiodophenol is sourced from PubChem (CID 156656919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).