C6H2F4IN — CID 118846195
2-(difluoromethyl)-4,6-difluoro-3-iodopyridine (PubChem CID 118846195) has the molecular formula C6H2F4IN and a molecular weight of 290.99 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,6-difluoro-3-iodopyridine.
| Compound Name | 2-(difluoromethyl)-4,6-difluoro-3-iodopyridine |
|---|---|
| PubChem CID | 118846195 |
| Molecular Formula | C6H2F4IN |
| Molecular Weight | 290.99 g/mol |
| Exact Mass | 290.92 |
| IUPAC Name | 2-(difluoromethyl)-4,6-difluoro-3-iodopyridine |
| SMILES | Fc1cc(F)c(I)c(C(F)F)n1 |
| InChI | InChI=1S/C6H2F4IN/c7-2-1-3(8)12-5(4(2)11)6(9)10/h1,6H |
| InChIKey | SABMHPSRHBLELQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.99 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|