C6H2Cl2F3N — CID 130099210
3,4-dichloro-2-(difluoromethyl)-6-fluoropyridine (PubChem CID 130099210) has the molecular formula C6H2Cl2F3N and a molecular weight of 215.99 g/mol. Its IUPAC name is 3,4-dichloro-2-(difluoromethyl)-6-fluoropyridine.
| Compound Name | 3,4-dichloro-2-(difluoromethyl)-6-fluoropyridine |
|---|---|
| PubChem CID | 130099210 |
| Molecular Formula | C6H2Cl2F3N |
| Molecular Weight | 215.99 g/mol |
| Exact Mass | 214.95 |
| IUPAC Name | 3,4-dichloro-2-(difluoromethyl)-6-fluoropyridine |
| SMILES | Fc1cc(Cl)c(Cl)c(C(F)F)n1 |
| InChI | InChI=1S/C6H2Cl2F3N/c7-2-1-3(9)12-5(4(2)8)6(10)11/h1,6H |
| InChIKey | UYRQIQRXPSDVKQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|