C7H7ClFN — CID 143020337
3-chloro-6-fluoro-2,4-dimethylpyridine (PubChem CID 143020337) has the molecular formula C7H7ClFN and a molecular weight of 159.59 g/mol. Its IUPAC name is 3-chloro-6-fluoro-2,4-dimethylpyridine.
| Compound Name | 3-chloro-6-fluoro-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 143020337 |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.59 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | 3-chloro-6-fluoro-2,4-dimethylpyridine |
| SMILES | Cc1cc(F)nc(C)c1Cl |
| InChI | InChI=1S/C7H7ClFN/c1-4-3-6(9)10-5(2)7(4)8/h3H,1-2H3 |
| InChIKey | RBMPBOSJSRDPTD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|