C9H13ClFN — CID 143020336
3-chloro-6-fluoro-2,4-dimethylpyridine;ethane (PubChem CID 143020336) has the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. Its IUPAC name is 3-chloro-6-fluoro-2,4-dimethylpyridine;ethane.
| Compound Name | 3-chloro-6-fluoro-2,4-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 143020336 |
| Molecular Formula | C9H13ClFN |
| Molecular Weight | 189.66 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-chloro-6-fluoro-2,4-dimethylpyridine;ethane |
| SMILES | CC.Cc1cc(F)nc(C)c1Cl |
| InChI | InChI=1S/C7H7ClFN.C2H6/c1-4-3-6(9)10-5(2)7(4)8;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | NKRFSCXBOJOHGM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|