C8H11Cl2NO — CID 142310785
4,6-dichloro-2-methylpyridin-3-ol;ethane (PubChem CID 142310785) has the molecular formula C8H11Cl2NO and a molecular weight of 208.09 g/mol. Its IUPAC name is 4,6-dichloro-2-methylpyridin-3-ol;ethane.
| Compound Name | 4,6-dichloro-2-methylpyridin-3-ol;ethane |
|---|---|
| PubChem CID | 142310785 |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 4,6-dichloro-2-methylpyridin-3-ol;ethane |
| SMILES | CC.Cc1nc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C6H5Cl2NO.C2H6/c1-3-6(10)4(7)2-5(8)9-3;1-2/h2,10H,1H3;1-2H3 |
| InChIKey | FOCSWCQSDOGCQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|