C14H15BCl3NO2 — CID 158355776
(3-chlorophenyl)boronic acid;4,6-dichloro-3-ethyl-2-methylpyridine (PubChem CID 158355776) has the molecular formula C14H15BCl3NO2 and a molecular weight of 346.45 g/mol. Its IUPAC name is (3-chlorophenyl)boronic acid;4,6-dichloro-3-ethyl-2-methylpyridine.
| Compound Name | (3-chlorophenyl)boronic acid;4,6-dichloro-3-ethyl-2-methylpyridine |
|---|---|
| PubChem CID | 158355776 |
| Molecular Formula | C14H15BCl3NO2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (3-chlorophenyl)boronic acid;4,6-dichloro-3-ethyl-2-methylpyridine |
| SMILES | CCc1c(Cl)cc(Cl)nc1C.OB(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2N.C6H6BClO2/c1-3-6-5(2)11-8(10)4-7(6)9;8-6-3-1-2-5(4-6)7(9)10/h4H,3H2,1-2H3;1-4,9-10H |
| InChIKey | GSVZLHFYPRHMHQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|