C13H11Cl3N2 — CID 63611300
4,6-dichloro-2-[(3-chlorophenyl)methyl]-5-ethylpyrimidine (PubChem CID 63611300) has the molecular formula C13H11Cl3N2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 4,6-dichloro-2-[(3-chlorophenyl)methyl]-5-ethylpyrimidine.
| Compound Name | 4,6-dichloro-2-[(3-chlorophenyl)methyl]-5-ethylpyrimidine |
|---|---|
| PubChem CID | 63611300 |
| Molecular Formula | C13H11Cl3N2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 4,6-dichloro-2-[(3-chlorophenyl)methyl]-5-ethylpyrimidine |
| SMILES | CCc1c(Cl)nc(Cc2cccc(Cl)c2)nc1Cl |
| InChI | InChI=1S/C13H11Cl3N2/c1-2-10-12(15)17-11(18-13(10)16)7-8-4-3-5-9(14)6-8/h3-6H,2,7H2,1H3 |
| InChIKey | VYUZISQARXMAJH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |