C11H9Cl3N4 — CID 54670841
4-[(3-chlorophenyl)methyl]-6-(dichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 54670841) has the molecular formula C11H9Cl3N4 and a molecular weight of 303.58 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-6-(dichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(3-chlorophenyl)methyl]-6-(dichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54670841 |
| Molecular Formula | C11H9Cl3N4 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-6-(dichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cc2cccc(Cl)c2)nc(C(Cl)Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N4/c12-7-3-1-2-6(4-7)5-8-16-10(9(13)14)18-11(15)17-8/h1-4,9H,5H2,(H2,15,16,17,18) |
| InChIKey | KMLLDVNAOXPMIB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|