C13H15BrN4 — CID 55251813
4-[(3-bromophenyl)methyl]-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 55251813) has the molecular formula C13H15BrN4 and a molecular weight of 307.20 g/mol. Its IUPAC name is 4-[(3-bromophenyl)methyl]-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-[(3-bromophenyl)methyl]-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55251813 |
| Molecular Formula | C13H15BrN4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-[(3-bromophenyl)methyl]-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N)nc(Cc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C13H15BrN4/c1-8(2)12-16-11(17-13(15)18-12)7-9-4-3-5-10(14)6-9/h3-6,8H,7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | BGXIYUWODHGCLM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |