C11H10BrN3O — CID 135966949
2-amino-4-[(3-bromophenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 135966949) has the molecular formula C11H10BrN3O and a molecular weight of 280.12 g/mol. Its IUPAC name is 2-amino-4-[(3-bromophenyl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[(3-bromophenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135966949 |
| Molecular Formula | C11H10BrN3O |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-amino-4-[(3-bromophenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(Cc2cccc(Br)c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H10BrN3O/c12-8-3-1-2-7(4-8)5-9-6-10(16)15-11(13)14-9/h1-4,6H,5H2,(H3,13,14,15,16) |
| InChIKey | UIWHODLSUMMVIR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |