C11H12BrN3 — CID 115092952
[5-[(3-bromophenyl)methyl]-1H-pyrazol-3-yl]methanamine (PubChem CID 115092952) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is [5-[(3-bromophenyl)methyl]-1H-pyrazol-3-yl]methanamine.
| Compound Name | [5-[(3-bromophenyl)methyl]-1H-pyrazol-3-yl]methanamine |
|---|---|
| PubChem CID | 115092952 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | [5-[(3-bromophenyl)methyl]-1H-pyrazol-3-yl]methanamine |
| SMILES | NCc1cc(Cc2cccc(Br)c2)[nH]n1 |
| InChI | InChI=1S/C11H12BrN3/c12-9-3-1-2-8(4-9)5-10-6-11(7-13)15-14-10/h1-4,6H,5,7,13H2,(H,14,15) |
| InChIKey | RQKOVWMAGONAKP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |